C18H18N2O4S2 — CID 2413900
[2-(3-methoxypropylamino)-2-oxoethyl] 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate (PubChem CID 2413900) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2413900 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
| SMILES | COCCCNC(=O)COC(=O)c1ccc(-c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C18H18N2O4S2/c1-23-10-4-9-19-16(21)11-24-18(22)15-8-7-14(25-15)17-20-12-5-2-3-6-13(12)26-17/h2-3,5-8H,4,9-11H2,1H3,(H,19,21) |
| InChIKey | SUTCTFKJDASADL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|