C16H19ClN4O7 — CID 2416971
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate (PubChem CID 2416971) has the molecular formula C16H19ClN4O7 and a molecular weight of 414.80 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2416971 |
| Molecular Formula | C16H19ClN4O7 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CNC(=O)c1cc(Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19ClN4O7/c1-16(2,3)20-15(25)19-12(22)8-28-13(23)7-18-14(24)9-4-10(17)6-11(5-9)21(26)27/h4-6H,7-8H2,1-3H3,(H,18,24)(H2,19,20,22,25) |
| InChIKey | YEJHAKYOOQPUGQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|