C18H13ClF2N2O7 — CID 2445156
[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate (PubChem CID 2445156) has the molecular formula C18H13ClF2N2O7 and a molecular weight of 442.76 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2445156 |
| Molecular Formula | C18H13ClF2N2O7 |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cc(Cl)cc([N+](=O)[O-])c1)OCC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H13ClF2N2O7/c19-12-5-11(6-13(7-12)23(27)28)17(26)22-8-16(25)29-9-15(24)10-1-3-14(4-2-10)30-18(20)21/h1-7,18H,8-9H2,(H,22,26) |
| InChIKey | GGIWEJPVSHWUMW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|