C15H12ClN5O6 — CID 2417909
[2-oxo-2-(pyrimidin-2-ylamino)ethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate (PubChem CID 2417909) has the molecular formula C15H12ClN5O6 and a molecular weight of 393.74 g/mol. Its IUPAC name is [2-oxo-2-(pyrimidin-2-ylamino)ethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(pyrimidin-2-ylamino)ethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2417909 |
| Molecular Formula | C15H12ClN5O6 |
| Molecular Weight | 393.74 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | [2-oxo-2-(pyrimidin-2-ylamino)ethyl] 2-[(3-chloro-5-nitrobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1cc(Cl)cc([N+](=O)[O-])c1)Nc1ncccn1 |
| InChI | InChI=1S/C15H12ClN5O6/c16-10-4-9(5-11(6-10)21(25)26)14(24)19-7-13(23)27-8-12(22)20-15-17-2-1-3-18-15/h1-6H,7-8H2,(H,19,24)(H,17,18,20,22) |
| InChIKey | JLUOYPSNIJRPSH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|