C15H15ClN4O2S — CID 2421303
ethyl (6R,7S)-7-(4-chlorophenyl)-5-methylidene-2-sulfanylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 2421303) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is ethyl (6R,7S)-7-(4-chlorophenyl)-5-methylidene-2-sulfanylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (6R,7S)-7-(4-chlorophenyl)-5-methylidene-2-sulfanylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2421303 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | ethyl (6R,7S)-7-(4-chlorophenyl)-5-methylidene-2-sulfanylidene-1,4,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=C1Nc2nc(=S)[nH]n2[C@H](c2ccc(Cl)cc2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C15H15ClN4O2S/c1-3-22-13(21)11-8(2)17-14-18-15(23)19-20(14)12(11)9-4-6-10(16)7-5-9/h4-7,11-12H,2-3H2,1H3,(H2,17,18,19,23)/t11-,12+/m0/s1 |
| InChIKey | QCBDNLOLWCBFIK-NWDGAFQWSA-N |
| XLogP | 3.30 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|