C13H19N2O3+ — CID 2421331
4-[(2R)-2-hydroxy-3-phenoxypropyl]piperazin-4-ium-2-one (PubChem CID 2421331) has the molecular formula C13H19N2O3+ and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-phenoxypropyl]piperazin-4-ium-2-one.
| Compound Name | 4-[(2R)-2-hydroxy-3-phenoxypropyl]piperazin-4-ium-2-one |
|---|---|
| PubChem CID | 2421331 |
| Molecular Formula | C13H19N2O3+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-phenoxypropyl]piperazin-4-ium-2-one |
| SMILES | O=C1C[NH+](C[C@@H](O)COc2ccccc2)CCN1 |
| InChI | InChI=1S/C13H18N2O3/c16-11(8-15-7-6-14-13(17)9-15)10-18-12-4-2-1-3-5-12/h1-5,11,16H,6-10H2,(H,14,17)/p+1/t11-/m1/s1 |
| InChIKey | VKLRVTPATLUBNA-LLVKDONJSA-O |
| XLogP | -1.56 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |