C26H26FN3O4S — CID 2421625
N-[2-[4-(diethylsulfamoyl)phenyl]-3H-isoindol-1-ylidene]-2-(3-fluorophenoxy)acetamide (PubChem CID 2421625) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[2-[4-(diethylsulfamoyl)phenyl]-3H-isoindol-1-ylidene]-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-[2-[4-(diethylsulfamoyl)phenyl]-3H-isoindol-1-ylidene]-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2421625 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[2-[4-(diethylsulfamoyl)phenyl]-3H-isoindol-1-ylidene]-2-(3-fluorophenoxy)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2Cc3ccccc3/C2=N\C(=O)COc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C26H26FN3O4S/c1-3-29(4-2)35(32,33)23-14-12-21(13-15-23)30-17-19-8-5-6-11-24(19)26(30)28-25(31)18-34-22-10-7-9-20(27)16-22/h5-16H,3-4,17-18H2,1-2H3/b28-26+ |
| InChIKey | SLKGMKVVTWSRQQ-BYCLXTJYSA-N |
| XLogP | 4.23 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|