C13H15BrNO5S- — CID 2422378
(2S)-1-(5-bromo-2-ethoxyphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 2422378) has the molecular formula C13H15BrNO5S- and a molecular weight of 377.24 g/mol. Its IUPAC name is (2S)-1-(5-bromo-2-ethoxyphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2S)-1-(5-bromo-2-ethoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2422378 |
| Molecular Formula | C13H15BrNO5S- |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (2S)-1-(5-bromo-2-ethoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N1CCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C13H16BrNO5S/c1-2-20-11-6-5-9(14)8-12(11)21(18,19)15-7-3-4-10(15)13(16)17/h5-6,8,10H,2-4,7H2,1H3,(H,16,17)/p-1/t10-/m0/s1 |
| InChIKey | JXWVHHGQVGPFLI-JTQLQIEISA-M |
| XLogP | 0.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |