C16H23N3O4S2 — CID 128570491
[1-[(4-ethoxy-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 128570491) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [1-[(4-ethoxy-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-[(4-ethoxy-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 128570491 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [1-[(4-ethoxy-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | CCOc1ccncc1S(=O)(=O)N1CCCC1C(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H23N3O4S2/c1-2-23-14-5-6-17-12-15(14)25(21,22)19-7-3-4-13(19)16(20)18-8-10-24-11-9-18/h5-6,12-13H,2-4,7-11H2,1H3 |
| InChIKey | AYZMTUBFDGZVOR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |