C13H20N4O3S2 — CID 95177278
[(2S)-1-(1-methylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 95177278) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [(2S)-1-(1-methylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [(2S)-1-(1-methylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95177278 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(2S)-1-(1-methylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | Cn1cc(S(=O)(=O)N2CCC[C@H]2C(=O)N2CCSCC2)cn1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-15-10-11(9-14-15)22(19,20)17-4-2-3-12(17)13(18)16-5-7-21-8-6-16/h9-10,12H,2-8H2,1H3/t12-/m0/s1 |
| InChIKey | VDJYTXNMZRTNBO-LBPRGKRZSA-N |
| XLogP | 0.15 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |