C20H23NO6 — CID 2426417
methyl 1-[2-[2-(6-methyl-1-benzofuran-3-yl)acetyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 2426417) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 1-[2-[2-(6-methyl-1-benzofuran-3-yl)acetyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[2-(6-methyl-1-benzofuran-3-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2426417 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 1-[2-[2-(6-methyl-1-benzofuran-3-yl)acetyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)Cc2coc3cc(C)ccc23)CC1 |
| InChI | InChI=1S/C20H23NO6/c1-13-3-4-16-15(11-26-17(16)9-13)10-19(23)27-12-18(22)21-7-5-14(6-8-21)20(24)25-2/h3-4,9,11,14H,5-8,10,12H2,1-2H3 |
| InChIKey | KSTVKQIWSPWYCJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |