C18H20N2O6 — CID 7807227
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7807227) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7807227 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | NC(=O)C1CCN(C(=O)COC(=O)Cc2coc3cc(O)ccc23)CC1 |
| InChI | InChI=1S/C18H20N2O6/c19-18(24)11-3-5-20(6-4-11)16(22)10-26-17(23)7-12-9-25-15-8-13(21)1-2-14(12)15/h1-2,8-9,11,21H,3-7,10H2,(H2,19,24) |
| InChIKey | FXRQLICXLSQRIF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |