C22H27NO4 — CID 8845835
[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 8845835) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8845835 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)OCC(=O)N3CC[C@@H]4CCCC[C@@H]4C3)coc2c1 |
| InChI | InChI=1S/C22H27NO4/c1-15-6-7-19-18(13-26-20(19)10-15)11-22(25)27-14-21(24)23-9-8-16-4-2-3-5-17(16)12-23/h6-7,10,13,16-17H,2-5,8-9,11-12,14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | VHXZFPZGYYEQMP-DLBZAZTESA-N |
| XLogP | 3.87 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |