C22H25N4O2S+ — CID 2426687
methyl (3R)-2-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate (PubChem CID 2426687) has the molecular formula C22H25N4O2S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is methyl (3R)-2-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate.
| Compound Name | methyl (3R)-2-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 2426687 |
| Molecular Formula | C22H25N4O2S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | methyl (3R)-2-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate |
| SMILES | CCc1ccc(-c2nc(=S)n(C[NH+]3Cc4ccccc4C[C@@H]3C(=O)OC)[nH]2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c1-3-15-8-10-16(11-9-15)20-23-22(29)26(24-20)14-25-13-18-7-5-4-6-17(18)12-19(25)21(27)28-2/h4-11,19H,3,12-14H2,1-2H3,(H,23,24,29)/p+1/t19-/m1/s1 |
| InChIKey | XRJPHOWOSMRKPB-LJQANCHMSA-O |
| XLogP | 2.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|