C24H29N3O3S2 — CID 2427256
N-[(1R,2S)-2-(3-butyl-4-oxoquinazolin-2-yl)sulfanylcyclohexyl]benzenesulfonamide (PubChem CID 2427256) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3-butyl-4-oxoquinazolin-2-yl)sulfanylcyclohexyl]benzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-(3-butyl-4-oxoquinazolin-2-yl)sulfanylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2427256 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[(1R,2S)-2-(3-butyl-4-oxoquinazolin-2-yl)sulfanylcyclohexyl]benzenesulfonamide |
| SMILES | CCCCn1c(S[C@H]2CCCC[C@H]2NS(=O)(=O)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H29N3O3S2/c1-2-3-17-27-23(28)19-13-7-8-14-20(19)25-24(27)31-22-16-10-9-15-21(22)26-32(29,30)18-11-5-4-6-12-18/h4-8,11-14,21-22,26H,2-3,9-10,15-17H2,1H3/t21-,22+/m1/s1 |
| InChIKey | IXLNONYXNNGKOW-YADHBBJMSA-N |
| XLogP | 4.58 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |