C28H30N2O4 — CID 2433708
[2-(2,6-diethylanilino)-2-oxoethyl] 2-[benzyl(methyl)carbamoyl]benzoate (PubChem CID 2433708) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 2-[benzyl(methyl)carbamoyl]benzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-[benzyl(methyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 2433708 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 2-[benzyl(methyl)carbamoyl]benzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccccc1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C28H30N2O4/c1-4-21-14-11-15-22(5-2)26(21)29-25(31)19-34-28(33)24-17-10-9-16-23(24)27(32)30(3)18-20-12-7-6-8-13-20/h6-17H,4-5,18-19H2,1-3H3,(H,29,31) |
| InChIKey | PLGKLWMAUOWQQE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |