C23H24Cl2N4OS — CID 2433819
2-[[5-(4-tert-butylphenyl)-4-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 2433819) has the molecular formula C23H24Cl2N4OS and a molecular weight of 475.45 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 2433819 |
| Molecular Formula | C23H24Cl2N4OS |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(2,3-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H24Cl2N4OS/c1-5-13-26-19(30)14-31-22-28-27-21(15-9-11-16(12-10-15)23(2,3)4)29(22)18-8-6-7-17(24)20(18)25/h5-12H,1,13-14H2,2-4H3,(H,26,30) |
| InChIKey | PCJOLMSSGLJMFB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|