C21H22ClN3S — CID 7564369
3-(4-tert-butylphenyl)-4-(2-chlorophenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole (PubChem CID 7564369) has the molecular formula C21H22ClN3S and a molecular weight of 383.95 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-4-(2-chlorophenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(4-tert-butylphenyl)-4-(2-chlorophenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 7564369 |
| Molecular Formula | C21H22ClN3S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(4-tert-butylphenyl)-4-(2-chlorophenyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
| SMILES | C=CCSc1nnc(-c2ccc(C(C)(C)C)cc2)n1-c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN3S/c1-5-14-26-20-24-23-19(25(20)18-9-7-6-8-17(18)22)15-10-12-16(13-11-15)21(2,3)4/h5-13H,1,14H2,2-4H3 |
| InChIKey | VKPNCQYJKPMUMC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|