C21H17F2NO3 — CID 2439825
ethyl (2Z,4E)-2-cyano-5-[4-(difluoromethoxy)phenyl]-3-phenylpenta-2,4-dienoate (PubChem CID 2439825) has the molecular formula C21H17F2NO3 and a molecular weight of 369.37 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-cyano-5-[4-(difluoromethoxy)phenyl]-3-phenylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-cyano-5-[4-(difluoromethoxy)phenyl]-3-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 2439825 |
| Molecular Formula | C21H17F2NO3 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl (2Z,4E)-2-cyano-5-[4-(difluoromethoxy)phenyl]-3-phenylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C#N)=C(/C=C/c1ccc(OC(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H17F2NO3/c1-2-26-20(25)19(14-24)18(16-6-4-3-5-7-16)13-10-15-8-11-17(12-9-15)27-21(22)23/h3-13,21H,2H2,1H3/b13-10+,19-18- |
| InChIKey | LYQUBZZZJQMALA-JORZPGEESA-N |
| XLogP | 4.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|