C14H10F3NO3S — CID 2442571
N-(2-acetylphenyl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 2442571) has the molecular formula C14H10F3NO3S and a molecular weight of 329.30 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(2-acetylphenyl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2442571 |
| Molecular Formula | C14H10F3NO3S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(2-acetylphenyl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F3NO3S/c1-8(19)9-4-2-3-5-11(9)18-22(20,21)12-7-6-10(15)13(16)14(12)17/h2-7,18H,1H3 |
| InChIKey | ZBXDPSHLUYDQBC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|