C18H18F3NO4 — CID 2443858
N-[3-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 2443858) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2443858 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18F3NO4/c1-24-14-7-11(8-15(25-2)17(14)26-3)9-16(23)22-13-6-4-5-12(10-13)18(19,20)21/h4-8,10H,9H2,1-3H3,(H,22,23) |
| InChIKey | VEVLWBWNNDAKAV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |