C23H18Cl2O2 — CID 2445358
[2-methyl-4-(4-methylphenyl)phenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 2445358) has the molecular formula C23H18Cl2O2 and a molecular weight of 397.30 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)phenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-methyl-4-(4-methylphenyl)phenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2445358 |
| Molecular Formula | C23H18Cl2O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)phenyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)/C=C/c3ccc(Cl)cc3Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C23H18Cl2O2/c1-15-3-5-17(6-4-15)19-8-11-22(16(2)13-19)27-23(26)12-9-18-7-10-20(24)14-21(18)25/h3-14H,1-2H3/b12-9+ |
| InChIKey | RPPYJCVWUPKADJ-FMIVXFBMSA-N |
| XLogP | 6.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|