C17H15Br2NO4S — CID 2448432
[2-(2,4-dibromoanilino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate (PubChem CID 2448432) has the molecular formula C17H15Br2NO4S and a molecular weight of 489.19 g/mol. Its IUPAC name is [2-(2,4-dibromoanilino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate.
| Compound Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 2448432 |
| Molecular Formula | C17H15Br2NO4S |
| Molecular Weight | 489.19 g/mol |
| Exact Mass | 486.91 |
| IUPAC Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
| SMILES | COc1cc(SC)ccc1C(=O)OCC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H15Br2NO4S/c1-23-15-8-11(25-2)4-5-12(15)17(22)24-9-16(21)20-14-6-3-10(18)7-13(14)19/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | NWORLGQPLQEFMT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |