C18H24N4O2S — CID 24505334
3-[[1-(1,3-benzothiazol-2-yl)ethyl-methylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 24505334) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[[1-(1,3-benzothiazol-2-yl)ethyl-methylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[1-(1,3-benzothiazol-2-yl)ethyl-methylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24505334 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[[1-(1,3-benzothiazol-2-yl)ethyl-methylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC1NC(=O)N(CN(C)C(C)c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C18H24N4O2S/c1-11(2)9-14-17(23)22(18(24)20-14)10-21(4)12(3)16-19-13-7-5-6-8-15(13)25-16/h5-8,11-12,14H,9-10H2,1-4H3,(H,20,24) |
| InChIKey | KQVOHKSOBSOMOM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|