C19H19N5S2 — CID 31540692
2-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 31540692) has the molecular formula C19H19N5S2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 2-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31540692 |
| Molecular Formula | C19H19N5S2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)Cn1ncn(-c2ccccc2)c1=S |
| InChI | InChI=1S/C19H19N5S2/c1-14(18-21-16-10-6-7-11-17(16)26-18)22(2)13-24-19(25)23(12-20-24)15-8-4-3-5-9-15/h3-12,14H,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | KCDBQVYDDYRPEM-CQSZACIVSA-N |
| XLogP | 4.66 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|