C20H22N6S2 — CID 9284842
1-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-(3,5-dimethylphenyl)tetrazole-5-thione (PubChem CID 9284842) has the molecular formula C20H22N6S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 1-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-(3,5-dimethylphenyl)tetrazole-5-thione.
| Compound Name | 1-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-(3,5-dimethylphenyl)tetrazole-5-thione |
|---|---|
| PubChem CID | 9284842 |
| Molecular Formula | C20H22N6S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-[[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]methyl]-4-(3,5-dimethylphenyl)tetrazole-5-thione |
| SMILES | Cc1cc(C)cc(-n2nnn(CN(C)[C@H](C)c3nc4ccccc4s3)c2=S)c1 |
| InChI | InChI=1S/C20H22N6S2/c1-13-9-14(2)11-16(10-13)26-20(27)25(22-23-26)12-24(4)15(3)19-21-17-7-5-6-8-18(17)28-19/h5-11,15H,12H2,1-4H3/t15-/m1/s1 |
| InChIKey | UUOMGNSRVYKKFM-OAHLLOKOSA-N |
| XLogP | 4.68 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|