C23H27N3O5S2 — CID 24505987
3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2-phenoxy-5-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 24505987) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2-phenoxy-5-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2-phenoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 24505987 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-(2-oxo-1,3-thiazolidin-3-yl)-N-(2-phenoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C23H27N3O5S2/c27-22(11-14-25-15-16-32-23(25)28)24-20-17-19(33(29,30)26-12-5-2-6-13-26)9-10-21(20)31-18-7-3-1-4-8-18/h1,3-4,7-10,17H,2,5-6,11-16H2,(H,24,27) |
| InChIKey | CRPNVIUZNPWTIZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|