C14H14N6O3S3 — CID 24508626
2-[[5-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 24508626) has the molecular formula C14H14N6O3S3 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[[5-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[5-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 24508626 |
| Molecular Formula | C14H14N6O3S3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[[5-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nnc(Sc2nc3ccccn3c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H14N6O3S3/c1-2-6-15-10(21)8-24-13-17-18-14(26-13)25-11-12(20(22)23)19-7-4-3-5-9(19)16-11/h3-5,7H,2,6,8H2,1H3,(H,15,21) |
| InChIKey | ORLGVIBQSKBMSN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|