C21H15N3O4S — CID 24509390
methyl 5-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 24509390) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is methyl 5-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24509390 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 5-[(4-oxo-3-phenylphthalazine-1-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)s1 |
| InChI | InChI=1S/C21H15N3O4S/c1-28-21(27)16-11-12-17(29-16)22-19(25)18-14-9-5-6-10-15(14)20(26)24(23-18)13-7-3-2-4-8-13/h2-12H,1H3,(H,22,25) |
| InChIKey | RJROZXCJJBGYBC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |