C16H13F3N4O2S — CID 24511385
3-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 24511385) has the molecular formula C16H13F3N4O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is 3-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 24511385 |
| Molecular Formula | C16H13F3N4O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N1CCCC1c1nnc2ccccn12 |
| InChI | InChI=1S/C16H13F3N4O2S/c17-10-6-7-12(15(19)14(10)18)26(24,25)23-9-3-4-11(23)16-21-20-13-5-1-2-8-22(13)16/h1-2,5-8,11H,3-4,9H2 |
| InChIKey | ALVAETMDXRDOGD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|