C20H24N4O2S — CID 26541642
3-[(2R)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 26541642) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[(2R)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(2R)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 26541642 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[(2R)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC[C@@H]2c2nnc3ccccn23)c1C |
| InChI | InChI=1S/C20H24N4O2S/c1-13-12-14(2)16(4)19(15(13)3)27(25,26)24-11-7-8-17(24)20-22-21-18-9-5-6-10-23(18)20/h5-6,9-10,12,17H,7-8,11H2,1-4H3/t17-/m1/s1 |
| InChIKey | RJGWVVFDEYFTBU-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |