C18H19N5O4S — CID 46650064
3-[1-(2,3-dimethyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 46650064) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 3-[1-(2,3-dimethyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-(2,3-dimethyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 46650064 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[1-(2,3-dimethyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCCC2c2nnc3ccccn23)c1C |
| InChI | InChI=1S/C18H19N5O4S/c1-12-10-14(23(24)25)11-16(13(12)2)28(26,27)22-9-5-6-15(22)18-20-19-17-7-3-4-8-21(17)18/h3-4,7-8,10-11,15H,5-6,9H2,1-2H3 |
| InChIKey | GXYCUHMZMMPXNQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|