C15H15N5O4S — CID 78820851
2,3-dimethyl-5-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 78820851) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2,3-dimethyl-5-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,3-dimethyl-5-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78820851 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2,3-dimethyl-5-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)NCc2nnc3ccccn23)c1C |
| InChI | InChI=1S/C15H15N5O4S/c1-10-7-12(20(21)22)8-13(11(10)2)25(23,24)16-9-15-18-17-14-5-3-4-6-19(14)15/h3-8,16H,9H2,1-2H3 |
| InChIKey | PESVOVSCTRZCGE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|