C21H29N7O4S — CID 43025699
N-[2-[di(propan-2-yl)amino]ethyl]-3-nitro-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)benzenesulfonamide (PubChem CID 43025699) has the molecular formula C21H29N7O4S and a molecular weight of 475.58 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-3-nitro-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)benzenesulfonamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-3-nitro-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43025699 |
| Molecular Formula | C21H29N7O4S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-3-nitro-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)benzenesulfonamide |
| SMILES | CC(C)N(CCNS(=O)(=O)c1ccc(NCc2nnc3ccccn23)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C21H29N7O4S/c1-15(2)26(16(3)4)12-10-23-33(31,32)17-8-9-18(19(13-17)28(29)30)22-14-21-25-24-20-7-5-6-11-27(20)21/h5-9,11,13,15-16,22-23H,10,12,14H2,1-4H3 |
| InChIKey | TVWNHUWSYXHFHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|