C17H18N4O4S — CID 16962560
N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 16962560) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16962560 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)NCCc2cn3ccccc3n2)c1C |
| InChI | InChI=1S/C17H18N4O4S/c1-12-9-15(21(22)23)10-16(13(12)2)26(24,25)18-7-6-14-11-20-8-4-3-5-17(20)19-14/h3-5,8-11,18H,6-7H2,1-2H3 |
| InChIKey | IBKGHMOGVQQYAW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|