C14H14N4O2S — CID 7150777
N-(2-imidazo[1,2-a]pyridin-2-ylethyl)pyridine-3-sulfonamide (PubChem CID 7150777) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-2-ylethyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 7150777 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1cn2ccccc2n1)c1cccnc1 |
| InChI | InChI=1S/C14H14N4O2S/c19-21(20,13-4-3-7-15-10-13)16-8-6-12-11-18-9-2-1-5-14(18)17-12/h1-5,7,9-11,16H,6,8H2 |
| InChIKey | YPLCJXBMDNJQGO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |