C19H17F2N3O4 — CID 24511409
N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide (PubChem CID 24511409) has the molecular formula C19H17F2N3O4 and a molecular weight of 389.36 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide |
|---|---|
| PubChem CID | 24511409 |
| Molecular Formula | C19H17F2N3O4 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]acetamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)CNc3ccc4c(c3)OC(F)(F)O4)ccc21 |
| InChI | InChI=1S/C19H17F2N3O4/c1-11(25)24-7-6-12-8-14(2-4-15(12)24)23-18(26)10-22-13-3-5-16-17(9-13)28-19(20,21)27-16/h2-5,8-9,22H,6-7,10H2,1H3,(H,23,26) |
| InChIKey | CLPHMMYSQYDJIL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|