C20H14FN5O3S — CID 24514494
2-(4-fluorophenyl)-4-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 24514494) has the molecular formula C20H14FN5O3S and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24514494 |
| Molecular Formula | C20H14FN5O3S |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H14FN5O3S/c1-10-16(30-20(22-10)11-6-8-12(21)9-7-11)19(29)26-25-18(28)15-13-4-2-3-5-14(13)17(27)24-23-15/h2-9H,1H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | QTLHGHBXXQHVSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|