C15H14Cl2N2O2S — CID 24525742
3-[1-(2,3-dichlorophenyl)sulfonylpyrrolidin-2-yl]pyridine (PubChem CID 24525742) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is 3-[1-(2,3-dichlorophenyl)sulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 3-[1-(2,3-dichlorophenyl)sulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 24525742 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-[1-(2,3-dichlorophenyl)sulfonylpyrrolidin-2-yl]pyridine |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C15H14Cl2N2O2S/c16-12-5-1-7-14(15(12)17)22(20,21)19-9-3-6-13(19)11-4-2-8-18-10-11/h1-2,4-5,7-8,10,13H,3,6,9H2 |
| InChIKey | NMFISZKGOACMRB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |