C20H19NO3 — CID 24530646
3-cyanopropyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 24530646) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-cyanopropyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | 3-cyanopropyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24530646 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-cyanopropyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)OCCCC#N)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-23-19-12-6-5-11-17(19)15-18(16-9-3-2-4-10-16)20(22)24-14-8-7-13-21/h2-6,9-12,15H,7-8,14H2,1H3/b18-15+ |
| InChIKey | BUEVXWIDADKQSW-OBGWFSINSA-N |
| XLogP | 4.08 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|