C23H22N2O5 — CID 46675232
(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 46675232) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 46675232 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1/C=C(/C(=O)OCc1cc(=O)n(C)c(=O)n1C)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O5/c1-24-18(14-21(26)25(2)23(24)28)15-30-22(27)19(16-9-5-4-6-10-16)13-17-11-7-8-12-20(17)29-3/h4-14H,15H2,1-3H3/b19-13+ |
| InChIKey | PQYCVDHYCJHMDU-CPNJWEJPSA-N |
| XLogP | 2.38 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|