C21H17FN2O4S — CID 24540880
N'-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 24540880) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is N'-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 24540880 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N'-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | COCc1c(C(=O)NNC(=O)c2oc3ccccc3c2C)sc2cccc(F)c12 |
| InChI | InChI=1S/C21H17FN2O4S/c1-11-12-6-3-4-8-15(12)28-18(11)20(25)23-24-21(26)19-13(10-27-2)17-14(22)7-5-9-16(17)29-19/h3-9H,10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | AWDVZKCONZHZCS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|