C21H21FN2O4S — CID 60599624
N'-[2-(2-ethylphenoxy)acetyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 60599624) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is N'-[2-(2-ethylphenoxy)acetyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2-ethylphenoxy)acetyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 60599624 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N'-[2-(2-ethylphenoxy)acetyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | CCc1ccccc1OCC(=O)NNC(=O)c1sc2cccc(F)c2c1COC |
| InChI | InChI=1S/C21H21FN2O4S/c1-3-13-7-4-5-9-16(13)28-12-18(25)23-24-21(26)20-14(11-27-2)19-15(22)8-6-10-17(19)29-20/h4-10H,3,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WIADMGROTZOZQT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|