C24H26FN3O5S — CID 25359971
[2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 25359971) has the molecular formula C24H26FN3O5S and a molecular weight of 487.55 g/mol. Its IUPAC name is [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 25359971 |
| Molecular Formula | C24H26FN3O5S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [2-[2-[4-(diethylamino)benzoyl]hydrazinyl]-2-oxoethyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)COC(=O)c2sc3cccc(F)c3c2COC)cc1 |
| InChI | InChI=1S/C24H26FN3O5S/c1-4-28(5-2)16-11-9-15(10-12-16)23(30)27-26-20(29)14-33-24(31)22-17(13-32-3)21-18(25)7-6-8-19(21)34-22/h6-12H,4-5,13-14H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | STNMYXXSKHKPIL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|