C21H19N5O3S — CID 24541645
N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 24541645) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24541645 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(OCc2nc(C(=O)NNC(=O)c3c(C)nc4ccccn34)cs2)cc1 |
| InChI | InChI=1S/C21H19N5O3S/c1-13-6-8-15(9-7-13)29-11-18-23-16(12-30-18)20(27)24-25-21(28)19-14(2)22-17-5-3-4-10-26(17)19/h3-10,12H,11H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | GRWLPFVIADTXMD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|