C23H25N3O5S — CID 25443390
N'-(3-methoxy-4-propoxybenzoyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 25443390) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N'-(3-methoxy-4-propoxybenzoyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(3-methoxy-4-propoxybenzoyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25443390 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N'-(3-methoxy-4-propoxybenzoyl)-2-[(4-methylphenoxy)methyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2csc(COc3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C23H25N3O5S/c1-4-11-30-19-10-7-16(12-20(19)29-3)22(27)25-26-23(28)18-14-32-21(24-18)13-31-17-8-5-15(2)6-9-17/h5-10,12,14H,4,11,13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | UIKWRPDDEVMSNZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|