C14H18Cl2N2O4S — CID 24542610
1-(2,5-dichlorophenyl)sulfonyl-N-methoxy-N-methylpiperidine-4-carboxamide (PubChem CID 24542610) has the molecular formula C14H18Cl2N2O4S and a molecular weight of 381.28 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-methoxy-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-methoxy-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24542610 |
| Molecular Formula | C14H18Cl2N2O4S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-methoxy-N-methylpiperidine-4-carboxamide |
| SMILES | CON(C)C(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O4S/c1-17(22-2)14(19)10-5-7-18(8-6-10)23(20,21)13-9-11(15)3-4-12(13)16/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | DWTQQGVGVSBLOE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|