C25H33N3O2 — CID 24542998
1-(naphthalene-1-carbonyl)-N-(1-propan-2-ylpiperidin-4-yl)piperidine-3-carboxamide (PubChem CID 24542998) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(naphthalene-1-carbonyl)-N-(1-propan-2-ylpiperidin-4-yl)piperidine-3-carboxamide.
| Compound Name | 1-(naphthalene-1-carbonyl)-N-(1-propan-2-ylpiperidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24542998 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-(naphthalene-1-carbonyl)-N-(1-propan-2-ylpiperidin-4-yl)piperidine-3-carboxamide |
| SMILES | CC(C)N1CCC(NC(=O)C2CCCN(C(=O)c3cccc4ccccc34)C2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-18(2)27-15-12-21(13-16-27)26-24(29)20-9-6-14-28(17-20)25(30)23-11-5-8-19-7-3-4-10-22(19)23/h3-5,7-8,10-11,18,20-21H,6,9,12-17H2,1-2H3,(H,26,29) |
| InChIKey | UFPOFZFTYVFSEF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |