C24H30N2O3 — CID 24544774
N-[(2S,3S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxopentan-2-yl]benzamide (PubChem CID 24544774) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[(2S,3S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 24544774 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[(2S,3S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxopentan-2-yl]benzamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)[C@@H](NC(=O)c2ccccc2)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-5-16-29-21-14-12-19(13-15-21)17-26(4)24(28)22(18(3)6-2)25-23(27)20-10-8-7-9-11-20/h5,7-15,18,22H,1,6,16-17H2,2-4H3,(H,25,27)/t18-,22-/m0/s1 |
| InChIKey | FMJUMVQHKPMQQC-AVRDEDQJSA-N |
| XLogP | 4.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|