C23H26F2N2O3 — CID 24544778
2,6-difluoro-N-[(2S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxobutan-2-yl]benzamide (PubChem CID 24544778) has the molecular formula C23H26F2N2O3 and a molecular weight of 416.47 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24544778 |
| Molecular Formula | C23H26F2N2O3 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2,6-difluoro-N-[(2S)-3-methyl-1-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-1-oxobutan-2-yl]benzamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)[C@@H](NC(=O)c2c(F)cccc2F)C(C)C)cc1 |
| InChI | InChI=1S/C23H26F2N2O3/c1-5-13-30-17-11-9-16(10-12-17)14-27(4)23(29)21(15(2)3)26-22(28)20-18(24)7-6-8-19(20)25/h5-12,15,21H,1,13-14H2,2-4H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | IUDAHDRHETUCOJ-NRFANRHFSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|